C6H14N2O3S — CID 96567876
(3R)-3-(methoxymethyl)pyrrolidine-1-sulfonamide (PubChem CID 96567876) has the molecular formula C6H14N2O3S and a molecular weight of 194.26 g/mol. Its IUPAC name is (3R)-3-(methoxymethyl)pyrrolidine-1-sulfonamide.
| Compound Name | (3R)-3-(methoxymethyl)pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 96567876 |
| Molecular Formula | C6H14N2O3S |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | (3R)-3-(methoxymethyl)pyrrolidine-1-sulfonamide |
| SMILES | COC[C@@H]1CCN(S(N)(=O)=O)C1 |
| InChI | InChI=1S/C6H14N2O3S/c1-11-5-6-2-3-8(4-6)12(7,9)10/h6H,2-5H2,1H3,(H2,7,9,10)/t6-/m1/s1 |
| InChIKey | ZGHRHQYHGQDHPX-ZCFIWIBFSA-N |
| XLogP | -0.84 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |