C17H22N2O3S — CID 96569221
N-[(1S,3S)-3-methoxy-2,2,3-trimethylcyclobutyl]-N-methyl-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide (PubChem CID 96569221) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is N-[(1S,3S)-3-methoxy-2,2,3-trimethylcyclobutyl]-N-methyl-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide.
| Compound Name | N-[(1S,3S)-3-methoxy-2,2,3-trimethylcyclobutyl]-N-methyl-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide |
|---|---|
| PubChem CID | 96569221 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | N-[(1S,3S)-3-methoxy-2,2,3-trimethylcyclobutyl]-N-methyl-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide |
| SMILES | CO[C@@]1(C)C[C@H](N(C)C(=O)c2ccc3[nH]c(=S)oc3c2)C1(C)C |
| InChI | InChI=1S/C17H22N2O3S/c1-16(2)13(9-17(16,3)21-5)19(4)14(20)10-6-7-11-12(8-10)22-15(23)18-11/h6-8,13H,9H2,1-5H3,(H,18,23)/t13-,17-/m0/s1 |
| InChIKey | WIOMVHIALISFIU-GUYCJALGSA-N |
| XLogP | 3.77 |
| TPSA | 58.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|