About 1-[(3R)-3-propan-2-yl-3,4-dihydro-2H-quinoxalin-1-yl]-3-pyridin-4-ylpropan-1-one
1-[(3R)-3-propan-2-yl-3,4-dihydro-2H-quinoxalin-1-yl]-3-pyridin-4-ylpropan-1-one (PubChem CID 96570260) has the molecular formula C19H23N3O
and a molecular weight of 309.41 g/mol. Its IUPAC name is 1-[(3R)-3-propan-2-yl-3,4-dihydro-2H-quinoxalin-1-yl]-3-pyridin-4-ylpropan-1-one.
Molecular Properties
| Compound Name | 1-[(3R)-3-propan-2-yl-3,4-dihydro-2H-quinoxalin-1-yl]-3-pyridin-4-ylpropan-1-one |
| PubChem CID | 96570260 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 1-[(3R)-3-propan-2-yl-3,4-dihydro-2H-quinoxalin-1-yl]-3-pyridin-4-ylpropan-1-one |
| SMILES | CC(C)[C@@H]1CN(C(=O)CCc2ccncc2)c2ccccc2N1 |
| InChI | InChI=1S/C19H23N3O/c1-14(2)17-13-22(18-6-4-3-5-16(18)21-17)19(23)8-7-15-9-11-20-12-10-15/h3-6,9-12,14,17,21H,7-8,13H2,1-2H3/t17-/m0/s1 |
| InChIKey | CZFBMOVCHVLOHI-KRWDZBQOSA-N |
| XLogP | 3.50 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(3R)-3-propan-2-yl-3,4-dihydro-2H-quinoxalin-1-yl]-3-pyridin-4-ylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3R)-3-propan-2-yl-3,4-dihydro-2H-quinoxalin-1-yl]-3-pyridin-4-ylpropan-1-one?
The IUPAC name of 1-[(3R)-3-propan-2-yl-3,4-dihydro-2H-quinoxalin-1-yl]-3-pyridin-4-ylpropan-1-one (CID 96570260) is 1-[(3R)-3-propan-2-yl-3,4-dihydro-2H-quinoxalin-1-yl]-3-pyridin-4-ylpropan-1-one.
What is the SMILES notation for 1-[(3R)-3-propan-2-yl-3,4-dihydro-2H-quinoxalin-1-yl]-3-pyridin-4-ylpropan-1-one?
The canonical SMILES for 1-[(3R)-3-propan-2-yl-3,4-dihydro-2H-quinoxalin-1-yl]-3-pyridin-4-ylpropan-1-one is CC(C)[C@@H]1CN(C(=O)CCc2ccncc2)c2ccccc2N1.
What is the InChIKey of 1-[(3R)-3-propan-2-yl-3,4-dihydro-2H-quinoxalin-1-yl]-3-pyridin-4-ylpropan-1-one?
The InChIKey is CZFBMOVCHVLOHI-KRWDZBQOSA-N. The full InChI is InChI=1S/C19H23N3O/c1-14(2)17-13-22(18-6-4-3-5-16(18)21-17)19(23)8-7-15-9-11-20-12-10-15/h3-6,9-12,14,17,21H,7-8,13H2,1-2H3/t17-/m0/s1.
What are the key properties of 1-[(3R)-3-propan-2-yl-3,4-dihydro-2H-quinoxalin-1-yl]-3-pyridin-4-ylpropan-1-one?
1-[(3R)-3-propan-2-yl-3,4-dihydro-2H-quinoxalin-1-yl]-3-pyridin-4-ylpropan-1-one has a molecular weight of 309.41 g/mol, XLogP of 3.50, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3R)-3-propan-2-yl-3,4-dihydro-2H-quinoxalin-1-yl]-3-pyridin-4-ylpropan-1-one is sourced from PubChem (CID 96570260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).