C11H14ClN — CID 96570849
(2R)-7-chloro-2,6-dimethyl-1,2,3,4-tetrahydroquinoline (PubChem CID 96570849) has the molecular formula C11H14ClN and a molecular weight of 195.69 g/mol. Its IUPAC name is (2R)-7-chloro-2,6-dimethyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | (2R)-7-chloro-2,6-dimethyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 96570849 |
| Molecular Formula | C11H14ClN |
| Molecular Weight | 195.69 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | (2R)-7-chloro-2,6-dimethyl-1,2,3,4-tetrahydroquinoline |
| SMILES | Cc1cc2c(cc1Cl)N[C@H](C)CC2 |
| InChI | InChI=1S/C11H14ClN/c1-7-5-9-4-3-8(2)13-11(9)6-10(7)12/h5-6,8,13H,3-4H2,1-2H3/t8-/m1/s1 |
| InChIKey | GTTBSKSOHRGXRD-MRVPVSSYSA-N |
| XLogP | 3.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.69 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |