C24H30N2O2 — CID 96571491
(2S)-1-(2-cyclohexylbenzimidazol-1-yl)-3-(3,4-dimethylphenoxy)propan-2-ol (PubChem CID 96571491) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is (2S)-1-(2-cyclohexylbenzimidazol-1-yl)-3-(3,4-dimethylphenoxy)propan-2-ol.
| Compound Name | (2S)-1-(2-cyclohexylbenzimidazol-1-yl)-3-(3,4-dimethylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 96571491 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | (2S)-1-(2-cyclohexylbenzimidazol-1-yl)-3-(3,4-dimethylphenoxy)propan-2-ol |
| SMILES | Cc1ccc(OC[C@@H](O)Cn2c(C3CCCCC3)nc3ccccc32)cc1C |
| InChI | InChI=1S/C24H30N2O2/c1-17-12-13-21(14-18(17)2)28-16-20(27)15-26-23-11-7-6-10-22(23)25-24(26)19-8-4-3-5-9-19/h6-7,10-14,19-20,27H,3-5,8-9,15-16H2,1-2H3/t20-/m0/s1 |
| InChIKey | RXRIRGGKCJNWMU-FQEVSTJZSA-N |
| XLogP | 5.14 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |