C20H22N2O3 — CID 96572832
N-[(3S)-3-(furan-2-yl)-3-phenylpropyl]-5-propyl-1,2-oxazole-3-carboxamide (PubChem CID 96572832) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-[(3S)-3-(furan-2-yl)-3-phenylpropyl]-5-propyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[(3S)-3-(furan-2-yl)-3-phenylpropyl]-5-propyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 96572832 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | N-[(3S)-3-(furan-2-yl)-3-phenylpropyl]-5-propyl-1,2-oxazole-3-carboxamide |
| SMILES | CCCc1cc(C(=O)NCC[C@@H](c2ccccc2)c2ccco2)no1 |
| InChI | InChI=1S/C20H22N2O3/c1-2-7-16-14-18(22-25-16)20(23)21-12-11-17(19-10-6-13-24-19)15-8-4-3-5-9-15/h3-6,8-10,13-14,17H,2,7,11-12H2,1H3,(H,21,23)/t17-/m0/s1 |
| InChIKey | UVMJENKCPQXRTL-KRWDZBQOSA-N |
| XLogP | 4.17 |
| TPSA | 68.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |