C21H29N3O3 — CID 96573973
1-[(3S)-3-[(3-methoxyphenoxy)methyl]piperidin-1-yl]-4-(2-methylimidazol-1-yl)butan-1-one (PubChem CID 96573973) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is 1-[(3S)-3-[(3-methoxyphenoxy)methyl]piperidin-1-yl]-4-(2-methylimidazol-1-yl)butan-1-one.
| Compound Name | 1-[(3S)-3-[(3-methoxyphenoxy)methyl]piperidin-1-yl]-4-(2-methylimidazol-1-yl)butan-1-one |
|---|---|
| PubChem CID | 96573973 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 1-[(3S)-3-[(3-methoxyphenoxy)methyl]piperidin-1-yl]-4-(2-methylimidazol-1-yl)butan-1-one |
| SMILES | COc1cccc(OC[C@H]2CCCN(C(=O)CCCn3ccnc3C)C2)c1 |
| InChI | InChI=1S/C21H29N3O3/c1-17-22-10-13-23(17)11-5-9-21(25)24-12-4-6-18(15-24)16-27-20-8-3-7-19(14-20)26-2/h3,7-8,10,13-14,18H,4-6,9,11-12,15-16H2,1-2H3/t18-/m0/s1 |
| InChIKey | UMCIXMQNSYQJMG-SFHVURJKSA-N |
| XLogP | 3.30 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |