C19H28ClNO3 — CID 96574016
(4R)-N-[3-(4-chlorophenoxy)propyl]-N-methyl-1,9-dioxaspiro[5.5]undecan-4-amine (PubChem CID 96574016) has the molecular formula C19H28ClNO3 and a molecular weight of 353.89 g/mol. Its IUPAC name is (4R)-N-[3-(4-chlorophenoxy)propyl]-N-methyl-1,9-dioxaspiro[5.5]undecan-4-amine.
| Compound Name | (4R)-N-[3-(4-chlorophenoxy)propyl]-N-methyl-1,9-dioxaspiro[5.5]undecan-4-amine |
|---|---|
| PubChem CID | 96574016 |
| Molecular Formula | C19H28ClNO3 |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | (4R)-N-[3-(4-chlorophenoxy)propyl]-N-methyl-1,9-dioxaspiro[5.5]undecan-4-amine |
| SMILES | CN(CCCOc1ccc(Cl)cc1)[C@@H]1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C19H28ClNO3/c1-21(10-2-11-23-18-5-3-16(20)4-6-18)17-7-12-24-19(15-17)8-13-22-14-9-19/h3-6,17H,2,7-15H2,1H3/t17-/m1/s1 |
| InChIKey | ZGTCKHPFSQKEAS-QGZVFWFLSA-N |
| XLogP | 3.77 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|