C21H21ClN4O — CID 96574429
(5R)-1-(3-chlorophenyl)-5-methyl-4-[(3-methylquinoxalin-2-yl)methyl]piperazin-2-one (PubChem CID 96574429) has the molecular formula C21H21ClN4O and a molecular weight of 380.88 g/mol. Its IUPAC name is (5R)-1-(3-chlorophenyl)-5-methyl-4-[(3-methylquinoxalin-2-yl)methyl]piperazin-2-one.
| Compound Name | (5R)-1-(3-chlorophenyl)-5-methyl-4-[(3-methylquinoxalin-2-yl)methyl]piperazin-2-one |
|---|---|
| PubChem CID | 96574429 |
| Molecular Formula | C21H21ClN4O |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | (5R)-1-(3-chlorophenyl)-5-methyl-4-[(3-methylquinoxalin-2-yl)methyl]piperazin-2-one |
| SMILES | Cc1nc2ccccc2nc1CN1CC(=O)N(c2cccc(Cl)c2)C[C@H]1C |
| InChI | InChI=1S/C21H21ClN4O/c1-14-11-26(17-7-5-6-16(22)10-17)21(27)13-25(14)12-20-15(2)23-18-8-3-4-9-19(18)24-20/h3-10,14H,11-13H2,1-2H3/t14-/m1/s1 |
| InChIKey | LIHQVNAGWPOFAM-CQSZACIVSA-N |
| XLogP | 3.83 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |