C25H37N3O2 — CID 96575197
(3R)-1-[1-(cyclopentanecarbonyl)piperidin-4-yl]-N-(2-phenylethyl)piperidine-3-carboxamide (PubChem CID 96575197) has the molecular formula C25H37N3O2 and a molecular weight of 411.59 g/mol. Its IUPAC name is (3R)-1-[1-(cyclopentanecarbonyl)piperidin-4-yl]-N-(2-phenylethyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-[1-(cyclopentanecarbonyl)piperidin-4-yl]-N-(2-phenylethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 96575197 |
| Molecular Formula | C25H37N3O2 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.29 |
| IUPAC Name | (3R)-1-[1-(cyclopentanecarbonyl)piperidin-4-yl]-N-(2-phenylethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCCc1ccccc1)[C@@H]1CCCN(C2CCN(C(=O)C3CCCC3)CC2)C1 |
| InChI | InChI=1S/C25H37N3O2/c29-24(26-15-12-20-7-2-1-3-8-20)22-11-6-16-28(19-22)23-13-17-27(18-14-23)25(30)21-9-4-5-10-21/h1-3,7-8,21-23H,4-6,9-19H2,(H,26,29)/t22-/m1/s1 |
| InChIKey | LHURMXNNWOQZAZ-JOCHJYFZSA-N |
| XLogP | 3.24 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |