C12H15N3O3 — CID 96576097
(5R)-7-[(2-methyl-1,3-oxazol-4-yl)methyl]-2,7-diazaspiro[4.4]nonane-1,3-dione (PubChem CID 96576097) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is (5R)-7-[(2-methyl-1,3-oxazol-4-yl)methyl]-2,7-diazaspiro[4.4]nonane-1,3-dione.
| Compound Name | (5R)-7-[(2-methyl-1,3-oxazol-4-yl)methyl]-2,7-diazaspiro[4.4]nonane-1,3-dione |
|---|---|
| PubChem CID | 96576097 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | (5R)-7-[(2-methyl-1,3-oxazol-4-yl)methyl]-2,7-diazaspiro[4.4]nonane-1,3-dione |
| SMILES | Cc1nc(CN2CC[C@@]3(CC(=O)NC3=O)C2)co1 |
| InChI | InChI=1S/C12H15N3O3/c1-8-13-9(6-18-8)5-15-3-2-12(7-15)4-10(16)14-11(12)17/h6H,2-5,7H2,1H3,(H,14,16,17)/t12-/m1/s1 |
| InChIKey | KAVDYGHAXUGPGZ-GFCCVEGCSA-N |
| XLogP | 0.22 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|