C21H32FN3O — CID 96576957
3-(3-fluorophenyl)-1-[4-[(1S)-1-(4-methylpiperazin-1-yl)ethyl]piperidin-1-yl]propan-1-one (PubChem CID 96576957) has the molecular formula C21H32FN3O and a molecular weight of 361.51 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-1-[4-[(1S)-1-(4-methylpiperazin-1-yl)ethyl]piperidin-1-yl]propan-1-one.
| Compound Name | 3-(3-fluorophenyl)-1-[4-[(1S)-1-(4-methylpiperazin-1-yl)ethyl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 96576957 |
| Molecular Formula | C21H32FN3O |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.25 |
| IUPAC Name | 3-(3-fluorophenyl)-1-[4-[(1S)-1-(4-methylpiperazin-1-yl)ethyl]piperidin-1-yl]propan-1-one |
| SMILES | C[C@@H](C1CCN(C(=O)CCc2cccc(F)c2)CC1)N1CCN(C)CC1 |
| InChI | InChI=1S/C21H32FN3O/c1-17(24-14-12-23(2)13-15-24)19-8-10-25(11-9-19)21(26)7-6-18-4-3-5-20(22)16-18/h3-5,16-17,19H,6-15H2,1-2H3/t17-/m0/s1 |
| InChIKey | VCCNIYUWBAKCML-KRWDZBQOSA-N |
| XLogP | 2.63 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |