About 4-methoxybenzene-1,2-dicarbonitrile
4-methoxybenzene-1,2-dicarbonitrile (PubChem CID 965781) has the molecular formula C9H6N2O
and a molecular weight of 158.16 g/mol. Its IUPAC name is 4-methoxybenzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4-methoxybenzene-1,2-dicarbonitrile |
| PubChem CID | 965781 |
| Molecular Formula | C9H6N2O |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 4-methoxybenzene-1,2-dicarbonitrile |
| SMILES | COc1ccc(C#N)c(C#N)c1 |
| InChI | InChI=1S/C9H6N2O/c1-12-9-3-2-7(5-10)8(4-9)6-11/h2-4H,1H3 |
| InChIKey | XERCEWVGKPPOMU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methoxybenzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxybenzene-1,2-dicarbonitrile?
The IUPAC name of 4-methoxybenzene-1,2-dicarbonitrile (CID 965781) is 4-methoxybenzene-1,2-dicarbonitrile.
What is the SMILES notation for 4-methoxybenzene-1,2-dicarbonitrile?
The canonical SMILES for 4-methoxybenzene-1,2-dicarbonitrile is COc1ccc(C#N)c(C#N)c1.
What is the InChIKey of 4-methoxybenzene-1,2-dicarbonitrile?
The InChIKey is XERCEWVGKPPOMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O/c1-12-9-3-2-7(5-10)8(4-9)6-11/h2-4H,1H3.
What are the key properties of 4-methoxybenzene-1,2-dicarbonitrile?
4-methoxybenzene-1,2-dicarbonitrile has a molecular weight of 158.16 g/mol, XLogP of 1.44, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxybenzene-1,2-dicarbonitrile is sourced from PubChem (CID 965781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).