C20H29N3O2 — CID 96578207
1-phenyl-4-[(4R)-4-piperidin-1-ylpentanoyl]piperazin-2-one (PubChem CID 96578207) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is 1-phenyl-4-[(4R)-4-piperidin-1-ylpentanoyl]piperazin-2-one.
| Compound Name | 1-phenyl-4-[(4R)-4-piperidin-1-ylpentanoyl]piperazin-2-one |
|---|---|
| PubChem CID | 96578207 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 1-phenyl-4-[(4R)-4-piperidin-1-ylpentanoyl]piperazin-2-one |
| SMILES | C[C@H](CCC(=O)N1CCN(c2ccccc2)C(=O)C1)N1CCCCC1 |
| InChI | InChI=1S/C20H29N3O2/c1-17(21-12-6-3-7-13-21)10-11-19(24)22-14-15-23(20(25)16-22)18-8-4-2-5-9-18/h2,4-5,8-9,17H,3,6-7,10-16H2,1H3/t17-/m1/s1 |
| InChIKey | ZQZLWTAOSHFQQI-QGZVFWFLSA-N |
| XLogP | 2.52 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |