C16H24F4N2O3 — CID 96579108
(6S)-2-ethyl-8-[2-(2,2,3,3-tetrafluoropropoxy)acetyl]-2,8-diazaspiro[5.5]undecan-3-one (PubChem CID 96579108) has the molecular formula C16H24F4N2O3 and a molecular weight of 368.37 g/mol. Its IUPAC name is (6S)-2-ethyl-8-[2-(2,2,3,3-tetrafluoropropoxy)acetyl]-2,8-diazaspiro[5.5]undecan-3-one.
| Compound Name | (6S)-2-ethyl-8-[2-(2,2,3,3-tetrafluoropropoxy)acetyl]-2,8-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 96579108 |
| Molecular Formula | C16H24F4N2O3 |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | (6S)-2-ethyl-8-[2-(2,2,3,3-tetrafluoropropoxy)acetyl]-2,8-diazaspiro[5.5]undecan-3-one |
| SMILES | CCN1C[C@]2(CCCN(C(=O)COCC(F)(F)C(F)F)C2)CCC1=O |
| InChI | InChI=1S/C16H24F4N2O3/c1-2-21-9-15(6-4-12(21)23)5-3-7-22(10-15)13(24)8-25-11-16(19,20)14(17)18/h14H,2-11H2,1H3/t15-/m0/s1 |
| InChIKey | FUKLWSNAHPZPGG-HNNXBMFYSA-N |
| XLogP | 2.15 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|