C18H22N4O3 — CID 96580301
1'-[(3R)-2-oxopiperidine-3-carbonyl]spiro[1,4-dihydroquinoxaline-3,4'-piperidine]-2-one (PubChem CID 96580301) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 1'-[(3R)-2-oxopiperidine-3-carbonyl]spiro[1,4-dihydroquinoxaline-3,4'-piperidine]-2-one.
| Compound Name | 1'-[(3R)-2-oxopiperidine-3-carbonyl]spiro[1,4-dihydroquinoxaline-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 96580301 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 1'-[(3R)-2-oxopiperidine-3-carbonyl]spiro[1,4-dihydroquinoxaline-3,4'-piperidine]-2-one |
| SMILES | O=C1NCCC[C@H]1C(=O)N1CCC2(CC1)Nc1ccccc1NC2=O |
| InChI | InChI=1S/C18H22N4O3/c23-15-12(4-3-9-19-15)16(24)22-10-7-18(8-11-22)17(25)20-13-5-1-2-6-14(13)21-18/h1-2,5-6,12,21H,3-4,7-11H2,(H,19,23)(H,20,25)/t12-/m1/s1 |
| InChIKey | HBNRFDKRONHICK-GFCCVEGCSA-N |
| XLogP | 0.94 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|