C11H19F2NO2 — CID 96581678
tert-butyl N-[(1S,2R)-2-(difluoromethyl)cyclopentyl]carbamate (PubChem CID 96581678) has the molecular formula C11H19F2NO2 and a molecular weight of 235.27 g/mol. Its IUPAC name is tert-butyl N-[(1S,2R)-2-(difluoromethyl)cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1S,2R)-2-(difluoromethyl)cyclopentyl]carbamate |
|---|---|
| PubChem CID | 96581678 |
| Molecular Formula | C11H19F2NO2 |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | tert-butyl N-[(1S,2R)-2-(difluoromethyl)cyclopentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCC[C@H]1C(F)F |
| InChI | InChI=1S/C11H19F2NO2/c1-11(2,3)16-10(15)14-8-6-4-5-7(8)9(12)13/h7-9H,4-6H2,1-3H3,(H,14,15)/t7-,8+/m1/s1 |
| InChIKey | RTJXKBCOFPFTAZ-SFYZADRCSA-N |
| XLogP | 2.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |