C7H14O3S — CID 96581730
trans-(1S,3S)-3-methylsulfonylcyclohexan-1-ol (PubChem CID 96581730) has the molecular formula C7H14O3S and a molecular weight of 178.25 g/mol. Its IUPAC name is trans-(1S,3S)-3-methylsulfonylcyclohexan-1-ol.
| Compound Name | trans-(1S,3S)-3-methylsulfonylcyclohexan-1-ol |
|---|---|
| PubChem CID | 96581730 |
| Molecular Formula | C7H14O3S |
| Molecular Weight | 178.25 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | trans-(1S,3S)-3-methylsulfonylcyclohexan-1-ol |
| SMILES | CS(=O)(=O)[C@H]1CCC[C@H](O)C1 |
| InChI | InChI=1S/C7H14O3S/c1-11(9,10)7-4-2-3-6(8)5-7/h6-8H,2-5H2,1H3/t6-,7-/m0/s1 |
| InChIKey | QXLWUYPXQYJLNB-BQBZGAKWSA-N |
| XLogP | 0.33 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.25 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |