About 6-(4-chlorophenyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine
6-(4-chlorophenyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine (PubChem CID 96590793) has the molecular formula C13H11ClN2
and a molecular weight of 230.70 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine.
Molecular Properties
| Compound Name | 6-(4-chlorophenyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine |
| PubChem CID | 96590793 |
| Molecular Formula | C13H11ClN2 |
| Molecular Weight | 230.70 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 6-(4-chlorophenyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine |
| SMILES | Clc1ccc(-c2cc3c(cn2)CNC3)cc1 |
| InChI | InChI=1S/C13H11ClN2/c14-12-3-1-9(2-4-12)13-5-10-6-15-7-11(10)8-16-13/h1-5,8,15H,6-7H2 |
| InChIKey | XAGPKIKEHJAJML-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.70 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(4-chlorophenyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-chlorophenyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine?
The IUPAC name of 6-(4-chlorophenyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine (CID 96590793) is 6-(4-chlorophenyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine.
What is the SMILES notation for 6-(4-chlorophenyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine?
The canonical SMILES for 6-(4-chlorophenyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine is Clc1ccc(-c2cc3c(cn2)CNC3)cc1.
What is the InChIKey of 6-(4-chlorophenyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine?
The InChIKey is XAGPKIKEHJAJML-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11ClN2/c14-12-3-1-9(2-4-12)13-5-10-6-15-7-11(10)8-16-13/h1-5,8,15H,6-7H2.
What are the key properties of 6-(4-chlorophenyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine?
6-(4-chlorophenyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine has a molecular weight of 230.70 g/mol, XLogP of 3.01, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-chlorophenyl)-2,3-dihydro-1H-pyrrolo[3,4-c]pyridine is sourced from PubChem (CID 96590793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).