C10H10BrNO — CID 96591675
1-(5-bromofuran-2-yl)-2,5-dimethylpyrrole (PubChem CID 96591675) has the molecular formula C10H10BrNO and a molecular weight of 240.10 g/mol. Its IUPAC name is 1-(5-bromofuran-2-yl)-2,5-dimethylpyrrole.
| Compound Name | 1-(5-bromofuran-2-yl)-2,5-dimethylpyrrole |
|---|---|
| PubChem CID | 96591675 |
| Molecular Formula | C10H10BrNO |
| Molecular Weight | 240.10 g/mol |
| Exact Mass | 238.99 |
| IUPAC Name | 1-(5-bromofuran-2-yl)-2,5-dimethylpyrrole |
| SMILES | Cc1ccc(C)n1-c1ccc(Br)o1 |
| InChI | InChI=1S/C10H10BrNO/c1-7-3-4-8(2)12(7)10-6-5-9(11)13-10/h3-6H,1-2H3 |
| InChIKey | IHOVMXFHIOCUCZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 18.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.10 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |