About 3-amino-6-methyl-2-propan-2-yl-5,7-dihydropyrrolo[3,4-b]pyridine-4-carboxylic acid
3-amino-6-methyl-2-propan-2-yl-5,7-dihydropyrrolo[3,4-b]pyridine-4-carboxylic acid (PubChem CID 96595547) has the molecular formula C12H17N3O2
and a molecular weight of 235.29 g/mol. Its IUPAC name is 3-amino-6-methyl-2-propan-2-yl-5,7-dihydropyrrolo[3,4-b]pyridine-4-carboxylic acid.
Molecular Properties
| Compound Name | 3-amino-6-methyl-2-propan-2-yl-5,7-dihydropyrrolo[3,4-b]pyridine-4-carboxylic acid |
| PubChem CID | 96595547 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 3-amino-6-methyl-2-propan-2-yl-5,7-dihydropyrrolo[3,4-b]pyridine-4-carboxylic acid |
| SMILES | CC(C)c1nc2c(c(C(=O)O)c1N)CN(C)C2 |
| InChI | InChI=1S/C12H17N3O2/c1-6(2)11-10(13)9(12(16)17)7-4-15(3)5-8(7)14-11/h6H,4-5,13H2,1-3H3,(H,16,17) |
| InChIKey | ZLCUPJUKZFDFNR-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-6-methyl-2-propan-2-yl-5,7-dihydropyrrolo[3,4-b]pyridine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-6-methyl-2-propan-2-yl-5,7-dihydropyrrolo[3,4-b]pyridine-4-carboxylic acid?
The IUPAC name of 3-amino-6-methyl-2-propan-2-yl-5,7-dihydropyrrolo[3,4-b]pyridine-4-carboxylic acid (CID 96595547) is 3-amino-6-methyl-2-propan-2-yl-5,7-dihydropyrrolo[3,4-b]pyridine-4-carboxylic acid.
What is the SMILES notation for 3-amino-6-methyl-2-propan-2-yl-5,7-dihydropyrrolo[3,4-b]pyridine-4-carboxylic acid?
The canonical SMILES for 3-amino-6-methyl-2-propan-2-yl-5,7-dihydropyrrolo[3,4-b]pyridine-4-carboxylic acid is CC(C)c1nc2c(c(C(=O)O)c1N)CN(C)C2.
What is the InChIKey of 3-amino-6-methyl-2-propan-2-yl-5,7-dihydropyrrolo[3,4-b]pyridine-4-carboxylic acid?
The InChIKey is ZLCUPJUKZFDFNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O2/c1-6(2)11-10(13)9(12(16)17)7-4-15(3)5-8(7)14-11/h6H,4-5,13H2,1-3H3,(H,16,17).
What are the key properties of 3-amino-6-methyl-2-propan-2-yl-5,7-dihydropyrrolo[3,4-b]pyridine-4-carboxylic acid?
3-amino-6-methyl-2-propan-2-yl-5,7-dihydropyrrolo[3,4-b]pyridine-4-carboxylic acid has a molecular weight of 235.29 g/mol, XLogP of 1.43, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-6-methyl-2-propan-2-yl-5,7-dihydropyrrolo[3,4-b]pyridine-4-carboxylic acid is sourced from PubChem (CID 96595547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).