C11H9NO3S — CID 96595834
1,1-dioxo-3,8-dihydro-2H-thieno[3,2-g]indole-7-carbaldehyde (PubChem CID 96595834) has the molecular formula C11H9NO3S and a molecular weight of 235.26 g/mol. Its IUPAC name is 1,1-dioxo-3,8-dihydro-2H-thieno[3,2-g]indole-7-carbaldehyde.
| Compound Name | 1,1-dioxo-3,8-dihydro-2H-thieno[3,2-g]indole-7-carbaldehyde |
|---|---|
| PubChem CID | 96595834 |
| Molecular Formula | C11H9NO3S |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.03 |
| IUPAC Name | 1,1-dioxo-3,8-dihydro-2H-thieno[3,2-g]indole-7-carbaldehyde |
| SMILES | O=Cc1cc2ccc3c(c2[nH]1)S(=O)(=O)CC3 |
| InChI | InChI=1S/C11H9NO3S/c13-6-9-5-8-2-1-7-3-4-16(14,15)11(7)10(8)12-9/h1-2,5-6,12H,3-4H2 |
| InChIKey | PBKKAJOHMHOTKD-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|