About 1-[(2R)-2-(2-methylpropyl)-2,3-dihydro-1H-pyrido[3,4-b]pyrazin-4-yl]ethanone
1-[(2R)-2-(2-methylpropyl)-2,3-dihydro-1H-pyrido[3,4-b]pyrazin-4-yl]ethanone (PubChem CID 96597656) has the molecular formula C13H19N3O
and a molecular weight of 233.31 g/mol. Its IUPAC name is 1-[(2R)-2-(2-methylpropyl)-2,3-dihydro-1H-pyrido[3,4-b]pyrazin-4-yl]ethanone.
Molecular Properties
| Compound Name | 1-[(2R)-2-(2-methylpropyl)-2,3-dihydro-1H-pyrido[3,4-b]pyrazin-4-yl]ethanone |
| PubChem CID | 96597656 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 1-[(2R)-2-(2-methylpropyl)-2,3-dihydro-1H-pyrido[3,4-b]pyrazin-4-yl]ethanone |
| SMILES | CC(=O)N1C[C@@H](CC(C)C)Nc2ccncc21 |
| InChI | InChI=1S/C13H19N3O/c1-9(2)6-11-8-16(10(3)17)13-7-14-5-4-12(13)15-11/h4-5,7,9,11,15H,6,8H2,1-3H3/t11-/m1/s1 |
| InChIKey | NVVAZHRLDUXRLX-LLVKDONJSA-N |
| XLogP | 2.27 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(2R)-2-(2-methylpropyl)-2,3-dihydro-1H-pyrido[3,4-b]pyrazin-4-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2R)-2-(2-methylpropyl)-2,3-dihydro-1H-pyrido[3,4-b]pyrazin-4-yl]ethanone?
The IUPAC name of 1-[(2R)-2-(2-methylpropyl)-2,3-dihydro-1H-pyrido[3,4-b]pyrazin-4-yl]ethanone (CID 96597656) is 1-[(2R)-2-(2-methylpropyl)-2,3-dihydro-1H-pyrido[3,4-b]pyrazin-4-yl]ethanone.
What is the SMILES notation for 1-[(2R)-2-(2-methylpropyl)-2,3-dihydro-1H-pyrido[3,4-b]pyrazin-4-yl]ethanone?
The canonical SMILES for 1-[(2R)-2-(2-methylpropyl)-2,3-dihydro-1H-pyrido[3,4-b]pyrazin-4-yl]ethanone is CC(=O)N1C[C@@H](CC(C)C)Nc2ccncc21.
What is the InChIKey of 1-[(2R)-2-(2-methylpropyl)-2,3-dihydro-1H-pyrido[3,4-b]pyrazin-4-yl]ethanone?
The InChIKey is NVVAZHRLDUXRLX-LLVKDONJSA-N. The full InChI is InChI=1S/C13H19N3O/c1-9(2)6-11-8-16(10(3)17)13-7-14-5-4-12(13)15-11/h4-5,7,9,11,15H,6,8H2,1-3H3/t11-/m1/s1.
What are the key properties of 1-[(2R)-2-(2-methylpropyl)-2,3-dihydro-1H-pyrido[3,4-b]pyrazin-4-yl]ethanone?
1-[(2R)-2-(2-methylpropyl)-2,3-dihydro-1H-pyrido[3,4-b]pyrazin-4-yl]ethanone has a molecular weight of 233.31 g/mol, XLogP of 2.27, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2R)-2-(2-methylpropyl)-2,3-dihydro-1H-pyrido[3,4-b]pyrazin-4-yl]ethanone is sourced from PubChem (CID 96597656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).