About 4-(2-methylphenyl)-2,3-dihydro-1H-indene-5-carbonitrile
4-(2-methylphenyl)-2,3-dihydro-1H-indene-5-carbonitrile (PubChem CID 96597680) has the molecular formula C17H15N
and a molecular weight of 233.31 g/mol. Its IUPAC name is 4-(2-methylphenyl)-2,3-dihydro-1H-indene-5-carbonitrile.
Molecular Properties
| Compound Name | 4-(2-methylphenyl)-2,3-dihydro-1H-indene-5-carbonitrile |
| PubChem CID | 96597680 |
| Molecular Formula | C17H15N |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 4-(2-methylphenyl)-2,3-dihydro-1H-indene-5-carbonitrile |
| SMILES | Cc1ccccc1-c1c(C#N)ccc2c1CCC2 |
| InChI | InChI=1S/C17H15N/c1-12-5-2-3-7-15(12)17-14(11-18)10-9-13-6-4-8-16(13)17/h2-3,5,7,9-10H,4,6,8H2,1H3 |
| InChIKey | XTFLUNXMLXUKTN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(2-methylphenyl)-2,3-dihydro-1H-indene-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methylphenyl)-2,3-dihydro-1H-indene-5-carbonitrile?
The IUPAC name of 4-(2-methylphenyl)-2,3-dihydro-1H-indene-5-carbonitrile (CID 96597680) is 4-(2-methylphenyl)-2,3-dihydro-1H-indene-5-carbonitrile.
What is the SMILES notation for 4-(2-methylphenyl)-2,3-dihydro-1H-indene-5-carbonitrile?
The canonical SMILES for 4-(2-methylphenyl)-2,3-dihydro-1H-indene-5-carbonitrile is Cc1ccccc1-c1c(C#N)ccc2c1CCC2.
What is the InChIKey of 4-(2-methylphenyl)-2,3-dihydro-1H-indene-5-carbonitrile?
The InChIKey is XTFLUNXMLXUKTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N/c1-12-5-2-3-7-15(12)17-14(11-18)10-9-13-6-4-8-16(13)17/h2-3,5,7,9-10H,4,6,8H2,1H3.
What are the key properties of 4-(2-methylphenyl)-2,3-dihydro-1H-indene-5-carbonitrile?
4-(2-methylphenyl)-2,3-dihydro-1H-indene-5-carbonitrile has a molecular weight of 233.31 g/mol, XLogP of 4.02, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylphenyl)-2,3-dihydro-1H-indene-5-carbonitrile is sourced from PubChem (CID 96597680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).