C11H12N4S — CID 96598684
5-methyl-13-thia-2,4,6-triazatricyclo[8.4.0.03,8]tetradeca-1,3,5,7,9-pentaen-7-amine (PubChem CID 96598684) has the molecular formula C11H12N4S and a molecular weight of 232.31 g/mol. Its IUPAC name is 5-methyl-13-thia-2,4,6-triazatricyclo[8.4.0.03,8]tetradeca-1,3,5,7,9-pentaen-7-amine.
| Compound Name | 5-methyl-13-thia-2,4,6-triazatricyclo[8.4.0.03,8]tetradeca-1,3,5,7,9-pentaen-7-amine |
|---|---|
| PubChem CID | 96598684 |
| Molecular Formula | C11H12N4S |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 5-methyl-13-thia-2,4,6-triazatricyclo[8.4.0.03,8]tetradeca-1,3,5,7,9-pentaen-7-amine |
| SMILES | Cc1nc(N)c2cc3c(nc2n1)CSCC3 |
| InChI | InChI=1S/C11H12N4S/c1-6-13-10(12)8-4-7-2-3-16-5-9(7)15-11(8)14-6/h4H,2-3,5H2,1H3,(H2,12,13,14,15) |
| InChIKey | RLVLJLJKZVYDOW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |