About 1,6-dimethyl-4-piperidin-4-ylpyrazolo[3,4-d]pyrimidine
1,6-dimethyl-4-piperidin-4-ylpyrazolo[3,4-d]pyrimidine (PubChem CID 96599519) has the molecular formula C12H17N5
and a molecular weight of 231.30 g/mol. Its IUPAC name is 1,6-dimethyl-4-piperidin-4-ylpyrazolo[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 1,6-dimethyl-4-piperidin-4-ylpyrazolo[3,4-d]pyrimidine |
| PubChem CID | 96599519 |
| Molecular Formula | C12H17N5 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 1,6-dimethyl-4-piperidin-4-ylpyrazolo[3,4-d]pyrimidine |
| SMILES | Cc1nc(C2CCNCC2)c2cnn(C)c2n1 |
| InChI | InChI=1S/C12H17N5/c1-8-15-11(9-3-5-13-6-4-9)10-7-14-17(2)12(10)16-8/h7,9,13H,3-6H2,1-2H3 |
| InChIKey | BAOWUYNRQAVPPT-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,6-dimethyl-4-piperidin-4-ylpyrazolo[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dimethyl-4-piperidin-4-ylpyrazolo[3,4-d]pyrimidine?
The IUPAC name of 1,6-dimethyl-4-piperidin-4-ylpyrazolo[3,4-d]pyrimidine (CID 96599519) is 1,6-dimethyl-4-piperidin-4-ylpyrazolo[3,4-d]pyrimidine.
What is the SMILES notation for 1,6-dimethyl-4-piperidin-4-ylpyrazolo[3,4-d]pyrimidine?
The canonical SMILES for 1,6-dimethyl-4-piperidin-4-ylpyrazolo[3,4-d]pyrimidine is Cc1nc(C2CCNCC2)c2cnn(C)c2n1.
What is the InChIKey of 1,6-dimethyl-4-piperidin-4-ylpyrazolo[3,4-d]pyrimidine?
The InChIKey is BAOWUYNRQAVPPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N5/c1-8-15-11(9-3-5-13-6-4-9)10-7-14-17(2)12(10)16-8/h7,9,13H,3-6H2,1-2H3.
What are the key properties of 1,6-dimethyl-4-piperidin-4-ylpyrazolo[3,4-d]pyrimidine?
1,6-dimethyl-4-piperidin-4-ylpyrazolo[3,4-d]pyrimidine has a molecular weight of 231.30 g/mol, XLogP of 1.14, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dimethyl-4-piperidin-4-ylpyrazolo[3,4-d]pyrimidine is sourced from PubChem (CID 96599519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).