About 8-amino-7-methyl-5,6-dihydro-1H-pyrrolo[3,2-f]indole-2-carboxylic acid
8-amino-7-methyl-5,6-dihydro-1H-pyrrolo[3,2-f]indole-2-carboxylic acid (PubChem CID 96599843) has the molecular formula C12H13N3O2
and a molecular weight of 231.25 g/mol. Its IUPAC name is 8-amino-7-methyl-5,6-dihydro-1H-pyrrolo[3,2-f]indole-2-carboxylic acid.
Molecular Properties
| Compound Name | 8-amino-7-methyl-5,6-dihydro-1H-pyrrolo[3,2-f]indole-2-carboxylic acid |
| PubChem CID | 96599843 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 8-amino-7-methyl-5,6-dihydro-1H-pyrrolo[3,2-f]indole-2-carboxylic acid |
| SMILES | CN1CCc2cc3cc(C(=O)O)[nH]c3c(N)c21 |
| InChI | InChI=1S/C12H13N3O2/c1-15-3-2-6-4-7-5-8(12(16)17)14-10(7)9(13)11(6)15/h4-5,14H,2-3,13H2,1H3,(H,16,17) |
| InChIKey | GHHWPIWDPCRTRI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 8-amino-7-methyl-5,6-dihydro-1H-pyrrolo[3,2-f]indole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-amino-7-methyl-5,6-dihydro-1H-pyrrolo[3,2-f]indole-2-carboxylic acid?
The IUPAC name of 8-amino-7-methyl-5,6-dihydro-1H-pyrrolo[3,2-f]indole-2-carboxylic acid (CID 96599843) is 8-amino-7-methyl-5,6-dihydro-1H-pyrrolo[3,2-f]indole-2-carboxylic acid.
What is the SMILES notation for 8-amino-7-methyl-5,6-dihydro-1H-pyrrolo[3,2-f]indole-2-carboxylic acid?
The canonical SMILES for 8-amino-7-methyl-5,6-dihydro-1H-pyrrolo[3,2-f]indole-2-carboxylic acid is CN1CCc2cc3cc(C(=O)O)[nH]c3c(N)c21.
What is the InChIKey of 8-amino-7-methyl-5,6-dihydro-1H-pyrrolo[3,2-f]indole-2-carboxylic acid?
The InChIKey is GHHWPIWDPCRTRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N3O2/c1-15-3-2-6-4-7-5-8(12(16)17)14-10(7)9(13)11(6)15/h4-5,14H,2-3,13H2,1H3,(H,16,17).
What are the key properties of 8-amino-7-methyl-5,6-dihydro-1H-pyrrolo[3,2-f]indole-2-carboxylic acid?
8-amino-7-methyl-5,6-dihydro-1H-pyrrolo[3,2-f]indole-2-carboxylic acid has a molecular weight of 231.25 g/mol, XLogP of 1.44, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-amino-7-methyl-5,6-dihydro-1H-pyrrolo[3,2-f]indole-2-carboxylic acid is sourced from PubChem (CID 96599843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).