About 2-[(2R,3R)-3-(aminomethyl)-1-propan-2-ylpiperidin-2-yl]-N,N-dimethylethanamine
2-[(2R,3R)-3-(aminomethyl)-1-propan-2-ylpiperidin-2-yl]-N,N-dimethylethanamine (PubChem CID 96602279) has the molecular formula C13H29N3
and a molecular weight of 227.40 g/mol. Its IUPAC name is 2-[(2R,3R)-3-(aminomethyl)-1-propan-2-ylpiperidin-2-yl]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[(2R,3R)-3-(aminomethyl)-1-propan-2-ylpiperidin-2-yl]-N,N-dimethylethanamine |
| PubChem CID | 96602279 |
| Molecular Formula | C13H29N3 |
| Molecular Weight | 227.40 g/mol |
| Exact Mass | 227.24 |
| IUPAC Name | 2-[(2R,3R)-3-(aminomethyl)-1-propan-2-ylpiperidin-2-yl]-N,N-dimethylethanamine |
| SMILES | CC(C)N1CCC[C@H](CN)[C@H]1CCN(C)C |
| InChI | InChI=1S/C13H29N3/c1-11(2)16-8-5-6-12(10-14)13(16)7-9-15(3)4/h11-13H,5-10,14H2,1-4H3/t12-,13-/m1/s1 |
| InChIKey | WNQAEFHMEWRUOF-CHWSQXEVSA-N |
| XLogP | 1.39 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.40 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2R,3R)-3-(aminomethyl)-1-propan-2-ylpiperidin-2-yl]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R,3R)-3-(aminomethyl)-1-propan-2-ylpiperidin-2-yl]-N,N-dimethylethanamine?
The IUPAC name of 2-[(2R,3R)-3-(aminomethyl)-1-propan-2-ylpiperidin-2-yl]-N,N-dimethylethanamine (CID 96602279) is 2-[(2R,3R)-3-(aminomethyl)-1-propan-2-ylpiperidin-2-yl]-N,N-dimethylethanamine.
What is the SMILES notation for 2-[(2R,3R)-3-(aminomethyl)-1-propan-2-ylpiperidin-2-yl]-N,N-dimethylethanamine?
The canonical SMILES for 2-[(2R,3R)-3-(aminomethyl)-1-propan-2-ylpiperidin-2-yl]-N,N-dimethylethanamine is CC(C)N1CCC[C@H](CN)[C@H]1CCN(C)C.
What is the InChIKey of 2-[(2R,3R)-3-(aminomethyl)-1-propan-2-ylpiperidin-2-yl]-N,N-dimethylethanamine?
The InChIKey is WNQAEFHMEWRUOF-CHWSQXEVSA-N. The full InChI is InChI=1S/C13H29N3/c1-11(2)16-8-5-6-12(10-14)13(16)7-9-15(3)4/h11-13H,5-10,14H2,1-4H3/t12-,13-/m1/s1.
What are the key properties of 2-[(2R,3R)-3-(aminomethyl)-1-propan-2-ylpiperidin-2-yl]-N,N-dimethylethanamine?
2-[(2R,3R)-3-(aminomethyl)-1-propan-2-ylpiperidin-2-yl]-N,N-dimethylethanamine has a molecular weight of 227.40 g/mol, XLogP of 1.39, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R,3R)-3-(aminomethyl)-1-propan-2-ylpiperidin-2-yl]-N,N-dimethylethanamine is sourced from PubChem (CID 96602279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).