C12H21NO3 — CID 96602470
tert-butyl (2S)-3-oxo-2-propan-2-ylpyrrolidine-1-carboxylate (PubChem CID 96602470) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is tert-butyl (2S)-3-oxo-2-propan-2-ylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-3-oxo-2-propan-2-ylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 96602470 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | tert-butyl (2S)-3-oxo-2-propan-2-ylpyrrolidine-1-carboxylate |
| SMILES | CC(C)[C@H]1C(=O)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H21NO3/c1-8(2)10-9(14)6-7-13(10)11(15)16-12(3,4)5/h8,10H,6-7H2,1-5H3/t10-/m0/s1 |
| InChIKey | RJMZLGWLBICATL-JTQLQIEISA-N |
| XLogP | 2.22 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |