About 2-[(2S,3R)-5-oxo-2-(1,3-thiazol-5-yl)pyrrolidin-3-yl]acetic acid
2-[(2S,3R)-5-oxo-2-(1,3-thiazol-5-yl)pyrrolidin-3-yl]acetic acid (PubChem CID 96603436) has the molecular formula C9H10N2O3S
and a molecular weight of 226.26 g/mol. Its IUPAC name is 2-[(2S,3R)-5-oxo-2-(1,3-thiazol-5-yl)pyrrolidin-3-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[(2S,3R)-5-oxo-2-(1,3-thiazol-5-yl)pyrrolidin-3-yl]acetic acid |
| PubChem CID | 96603436 |
| Molecular Formula | C9H10N2O3S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 2-[(2S,3R)-5-oxo-2-(1,3-thiazol-5-yl)pyrrolidin-3-yl]acetic acid |
| SMILES | O=C(O)C[C@H]1CC(=O)N[C@@H]1c1cncs1 |
| InChI | InChI=1S/C9H10N2O3S/c12-7-1-5(2-8(13)14)9(11-7)6-3-10-4-15-6/h3-5,9H,1-2H2,(H,11,12)(H,13,14)/t5-,9+/m1/s1 |
| InChIKey | RJDRZLWXOJRWJN-ANLVUFKYSA-N |
| XLogP | 0.80 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2S,3R)-5-oxo-2-(1,3-thiazol-5-yl)pyrrolidin-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S,3R)-5-oxo-2-(1,3-thiazol-5-yl)pyrrolidin-3-yl]acetic acid?
The IUPAC name of 2-[(2S,3R)-5-oxo-2-(1,3-thiazol-5-yl)pyrrolidin-3-yl]acetic acid (CID 96603436) is 2-[(2S,3R)-5-oxo-2-(1,3-thiazol-5-yl)pyrrolidin-3-yl]acetic acid.
What is the SMILES notation for 2-[(2S,3R)-5-oxo-2-(1,3-thiazol-5-yl)pyrrolidin-3-yl]acetic acid?
The canonical SMILES for 2-[(2S,3R)-5-oxo-2-(1,3-thiazol-5-yl)pyrrolidin-3-yl]acetic acid is O=C(O)C[C@H]1CC(=O)N[C@@H]1c1cncs1.
What is the InChIKey of 2-[(2S,3R)-5-oxo-2-(1,3-thiazol-5-yl)pyrrolidin-3-yl]acetic acid?
The InChIKey is RJDRZLWXOJRWJN-ANLVUFKYSA-N. The full InChI is InChI=1S/C9H10N2O3S/c12-7-1-5(2-8(13)14)9(11-7)6-3-10-4-15-6/h3-5,9H,1-2H2,(H,11,12)(H,13,14)/t5-,9+/m1/s1.
What are the key properties of 2-[(2S,3R)-5-oxo-2-(1,3-thiazol-5-yl)pyrrolidin-3-yl]acetic acid?
2-[(2S,3R)-5-oxo-2-(1,3-thiazol-5-yl)pyrrolidin-3-yl]acetic acid has a molecular weight of 226.26 g/mol, XLogP of 0.80, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S,3R)-5-oxo-2-(1,3-thiazol-5-yl)pyrrolidin-3-yl]acetic acid is sourced from PubChem (CID 96603436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).