About 2-[methyl(1,3-oxazol-2-yl)amino]-1,3-thiazole-5-carboxylic acid
2-[methyl(1,3-oxazol-2-yl)amino]-1,3-thiazole-5-carboxylic acid (PubChem CID 96604205) has the molecular formula C8H7N3O3S
and a molecular weight of 225.23 g/mol. Its IUPAC name is 2-[methyl(1,3-oxazol-2-yl)amino]-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-[methyl(1,3-oxazol-2-yl)amino]-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 96604205 |
| Molecular Formula | C8H7N3O3S |
| Molecular Weight | 225.23 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | 2-[methyl(1,3-oxazol-2-yl)amino]-1,3-thiazole-5-carboxylic acid |
| SMILES | CN(c1ncco1)c1ncc(C(=O)O)s1 |
| InChI | InChI=1S/C8H7N3O3S/c1-11(7-9-2-3-14-7)8-10-4-5(15-8)6(12)13/h2-4H,1H3,(H,12,13) |
| InChIKey | NVCQIGANCOEQPB-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.23 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[methyl(1,3-oxazol-2-yl)amino]-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[methyl(1,3-oxazol-2-yl)amino]-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-[methyl(1,3-oxazol-2-yl)amino]-1,3-thiazole-5-carboxylic acid (CID 96604205) is 2-[methyl(1,3-oxazol-2-yl)amino]-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-[methyl(1,3-oxazol-2-yl)amino]-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-[methyl(1,3-oxazol-2-yl)amino]-1,3-thiazole-5-carboxylic acid is CN(c1ncco1)c1ncc(C(=O)O)s1.
What is the InChIKey of 2-[methyl(1,3-oxazol-2-yl)amino]-1,3-thiazole-5-carboxylic acid?
The InChIKey is NVCQIGANCOEQPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O3S/c1-11(7-9-2-3-14-7)8-10-4-5(15-8)6(12)13/h2-4H,1H3,(H,12,13).
What are the key properties of 2-[methyl(1,3-oxazol-2-yl)amino]-1,3-thiazole-5-carboxylic acid?
2-[methyl(1,3-oxazol-2-yl)amino]-1,3-thiazole-5-carboxylic acid has a molecular weight of 225.23 g/mol, XLogP of 1.60, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methyl(1,3-oxazol-2-yl)amino]-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 96604205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).