About 3-piperidin-4-ylthieno[3,2-d][1,2]thiazole
3-piperidin-4-ylthieno[3,2-d][1,2]thiazole (PubChem CID 96604516) has the molecular formula C10H12N2S2
and a molecular weight of 224.35 g/mol. Its IUPAC name is 3-piperidin-4-ylthieno[3,2-d][1,2]thiazole.
Molecular Properties
| Compound Name | 3-piperidin-4-ylthieno[3,2-d][1,2]thiazole |
| PubChem CID | 96604516 |
| Molecular Formula | C10H12N2S2 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 3-piperidin-4-ylthieno[3,2-d][1,2]thiazole |
| SMILES | c1cc2c(C3CCNCC3)nsc2s1 |
| InChI | InChI=1S/C10H12N2S2/c1-4-11-5-2-7(1)9-8-3-6-13-10(8)14-12-9/h3,6-7,11H,1-2,4-5H2 |
| InChIKey | PPORCEYLLZOZIB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-piperidin-4-ylthieno[3,2-d][1,2]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-piperidin-4-ylthieno[3,2-d][1,2]thiazole?
The IUPAC name of 3-piperidin-4-ylthieno[3,2-d][1,2]thiazole (CID 96604516) is 3-piperidin-4-ylthieno[3,2-d][1,2]thiazole.
What is the SMILES notation for 3-piperidin-4-ylthieno[3,2-d][1,2]thiazole?
The canonical SMILES for 3-piperidin-4-ylthieno[3,2-d][1,2]thiazole is c1cc2c(C3CCNCC3)nsc2s1.
What is the InChIKey of 3-piperidin-4-ylthieno[3,2-d][1,2]thiazole?
The InChIKey is PPORCEYLLZOZIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2S2/c1-4-11-5-2-7(1)9-8-3-6-13-10(8)14-12-9/h3,6-7,11H,1-2,4-5H2.
What are the key properties of 3-piperidin-4-ylthieno[3,2-d][1,2]thiazole?
3-piperidin-4-ylthieno[3,2-d][1,2]thiazole has a molecular weight of 224.35 g/mol, XLogP of 2.82, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-piperidin-4-ylthieno[3,2-d][1,2]thiazole is sourced from PubChem (CID 96604516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).