C12H14FNO2 — CID 96605871
11-fluoro-3,4,7,8,9,10-hexahydro-2H-[1,4]dioxepino[2,3-g]quinoline (PubChem CID 96605871) has the molecular formula C12H14FNO2 and a molecular weight of 223.25 g/mol. Its IUPAC name is 11-fluoro-3,4,7,8,9,10-hexahydro-2H-[1,4]dioxepino[2,3-g]quinoline.
| Compound Name | 11-fluoro-3,4,7,8,9,10-hexahydro-2H-[1,4]dioxepino[2,3-g]quinoline |
|---|---|
| PubChem CID | 96605871 |
| Molecular Formula | C12H14FNO2 |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 11-fluoro-3,4,7,8,9,10-hexahydro-2H-[1,4]dioxepino[2,3-g]quinoline |
| SMILES | Fc1c2c(cc3c1OCCCO3)NCCC2 |
| InChI | InChI=1S/C12H14FNO2/c13-11-8-3-1-4-14-9(8)7-10-12(11)16-6-2-5-15-10/h7,14H,1-6H2 |
| InChIKey | IZKVXRKSTMRRNU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|