About 8-(2-aminoethyl)-7-ethyl-1-methyl-2,3-dihydroimidazo[1,2-a]pyridin-5-one
8-(2-aminoethyl)-7-ethyl-1-methyl-2,3-dihydroimidazo[1,2-a]pyridin-5-one (PubChem CID 96607003) has the molecular formula C12H19N3O
and a molecular weight of 221.30 g/mol. Its IUPAC name is 8-(2-aminoethyl)-7-ethyl-1-methyl-2,3-dihydroimidazo[1,2-a]pyridin-5-one.
Molecular Properties
| Compound Name | 8-(2-aminoethyl)-7-ethyl-1-methyl-2,3-dihydroimidazo[1,2-a]pyridin-5-one |
| PubChem CID | 96607003 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 8-(2-aminoethyl)-7-ethyl-1-methyl-2,3-dihydroimidazo[1,2-a]pyridin-5-one |
| SMILES | CCc1cc(=O)n2c(c1CCN)N(C)CC2 |
| InChI | InChI=1S/C12H19N3O/c1-3-9-8-11(16)15-7-6-14(2)12(15)10(9)4-5-13/h8H,3-7,13H2,1-2H3 |
| InChIKey | YVKGEPIGFSAFNI-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-(2-aminoethyl)-7-ethyl-1-methyl-2,3-dihydroimidazo[1,2-a]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2-aminoethyl)-7-ethyl-1-methyl-2,3-dihydroimidazo[1,2-a]pyridin-5-one?
The IUPAC name of 8-(2-aminoethyl)-7-ethyl-1-methyl-2,3-dihydroimidazo[1,2-a]pyridin-5-one (CID 96607003) is 8-(2-aminoethyl)-7-ethyl-1-methyl-2,3-dihydroimidazo[1,2-a]pyridin-5-one.
What is the SMILES notation for 8-(2-aminoethyl)-7-ethyl-1-methyl-2,3-dihydroimidazo[1,2-a]pyridin-5-one?
The canonical SMILES for 8-(2-aminoethyl)-7-ethyl-1-methyl-2,3-dihydroimidazo[1,2-a]pyridin-5-one is CCc1cc(=O)n2c(c1CCN)N(C)CC2.
What is the InChIKey of 8-(2-aminoethyl)-7-ethyl-1-methyl-2,3-dihydroimidazo[1,2-a]pyridin-5-one?
The InChIKey is YVKGEPIGFSAFNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O/c1-3-9-8-11(16)15-7-6-14(2)12(15)10(9)4-5-13/h8H,3-7,13H2,1-2H3.
What are the key properties of 8-(2-aminoethyl)-7-ethyl-1-methyl-2,3-dihydroimidazo[1,2-a]pyridin-5-one?
8-(2-aminoethyl)-7-ethyl-1-methyl-2,3-dihydroimidazo[1,2-a]pyridin-5-one has a molecular weight of 221.30 g/mol, XLogP of 0.36, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2-aminoethyl)-7-ethyl-1-methyl-2,3-dihydroimidazo[1,2-a]pyridin-5-one is sourced from PubChem (CID 96607003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).