About 6-bromo-2,3-dihydrothieno[2,3-b][1,4]dioxine
6-bromo-2,3-dihydrothieno[2,3-b][1,4]dioxine (PubChem CID 96607626) has the molecular formula C6H5BrO2S
and a molecular weight of 221.07 g/mol. Its IUPAC name is 6-bromo-2,3-dihydrothieno[2,3-b][1,4]dioxine.
Molecular Properties
| Compound Name | 6-bromo-2,3-dihydrothieno[2,3-b][1,4]dioxine |
| PubChem CID | 96607626 |
| Molecular Formula | C6H5BrO2S |
| Molecular Weight | 221.07 g/mol |
| Exact Mass | 219.92 |
| IUPAC Name | 6-bromo-2,3-dihydrothieno[2,3-b][1,4]dioxine |
| SMILES | Brc1cc2c(s1)OCCO2 |
| InChI | InChI=1S/C6H5BrO2S/c7-5-3-4-6(10-5)9-2-1-8-4/h3H,1-2H2 |
| InChIKey | MLWGIJMPGNXMAI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.07 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-2,3-dihydrothieno[2,3-b][1,4]dioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2,3-dihydrothieno[2,3-b][1,4]dioxine?
The IUPAC name of 6-bromo-2,3-dihydrothieno[2,3-b][1,4]dioxine (CID 96607626) is 6-bromo-2,3-dihydrothieno[2,3-b][1,4]dioxine.
What is the SMILES notation for 6-bromo-2,3-dihydrothieno[2,3-b][1,4]dioxine?
The canonical SMILES for 6-bromo-2,3-dihydrothieno[2,3-b][1,4]dioxine is Brc1cc2c(s1)OCCO2.
What is the InChIKey of 6-bromo-2,3-dihydrothieno[2,3-b][1,4]dioxine?
The InChIKey is MLWGIJMPGNXMAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BrO2S/c7-5-3-4-6(10-5)9-2-1-8-4/h3H,1-2H2.
What are the key properties of 6-bromo-2,3-dihydrothieno[2,3-b][1,4]dioxine?
6-bromo-2,3-dihydrothieno[2,3-b][1,4]dioxine has a molecular weight of 221.07 g/mol, XLogP of 2.28, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2,3-dihydrothieno[2,3-b][1,4]dioxine is sourced from PubChem (CID 96607626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).