About 5-propan-2-yl-3,4-dihydro-1H-isothiochromene-6-carbonitrile
5-propan-2-yl-3,4-dihydro-1H-isothiochromene-6-carbonitrile (PubChem CID 96610343) has the molecular formula C13H15NS
and a molecular weight of 217.34 g/mol. Its IUPAC name is 5-propan-2-yl-3,4-dihydro-1H-isothiochromene-6-carbonitrile.
Molecular Properties
| Compound Name | 5-propan-2-yl-3,4-dihydro-1H-isothiochromene-6-carbonitrile |
| PubChem CID | 96610343 |
| Molecular Formula | C13H15NS |
| Molecular Weight | 217.34 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 5-propan-2-yl-3,4-dihydro-1H-isothiochromene-6-carbonitrile |
| SMILES | CC(C)c1c(C#N)ccc2c1CCSC2 |
| InChI | InChI=1S/C13H15NS/c1-9(2)13-10(7-14)3-4-11-8-15-6-5-12(11)13/h3-4,9H,5-6,8H2,1-2H3 |
| InChIKey | BCOBWHOPBPBUKJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-propan-2-yl-3,4-dihydro-1H-isothiochromene-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propan-2-yl-3,4-dihydro-1H-isothiochromene-6-carbonitrile?
The IUPAC name of 5-propan-2-yl-3,4-dihydro-1H-isothiochromene-6-carbonitrile (CID 96610343) is 5-propan-2-yl-3,4-dihydro-1H-isothiochromene-6-carbonitrile.
What is the SMILES notation for 5-propan-2-yl-3,4-dihydro-1H-isothiochromene-6-carbonitrile?
The canonical SMILES for 5-propan-2-yl-3,4-dihydro-1H-isothiochromene-6-carbonitrile is CC(C)c1c(C#N)ccc2c1CCSC2.
What is the InChIKey of 5-propan-2-yl-3,4-dihydro-1H-isothiochromene-6-carbonitrile?
The InChIKey is BCOBWHOPBPBUKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NS/c1-9(2)13-10(7-14)3-4-11-8-15-6-5-12(11)13/h3-4,9H,5-6,8H2,1-2H3.
What are the key properties of 5-propan-2-yl-3,4-dihydro-1H-isothiochromene-6-carbonitrile?
5-propan-2-yl-3,4-dihydro-1H-isothiochromene-6-carbonitrile has a molecular weight of 217.34 g/mol, XLogP of 3.47, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propan-2-yl-3,4-dihydro-1H-isothiochromene-6-carbonitrile is sourced from PubChem (CID 96610343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).