4-(2-methyl-1,3-oxazol-4-yl)oxane-4-carboxylic acid

C10H13NO4 — CID 96613959

IUPAC4-(2-methyl-1,3-oxazol-4-yl)oxane-4-carboxylic acid
SMILESCc1nc(C2(C(=O)O)CCOCC2)co1
InChIInChI=1S/C10H13NO4/c1-7-11-8(6-15-7)10(9(12)13)2-4-14-5-3-10/h6H,2-5H2,1H3,(H,12,13)
InChIKeyFKMZMQJBSAXXEA-UHFFFAOYSA-N
MW211.22 g/mol
LogP1.12
Rot. Bonds2

About 4-(2-methyl-1,3-oxazol-4-yl)oxane-4-carboxylic acid

4-(2-methyl-1,3-oxazol-4-yl)oxane-4-carboxylic acid (PubChem CID 96613959) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is 4-(2-methyl-1,3-oxazol-4-yl)oxane-4-carboxylic acid.

Molecular Properties

Compound Name4-(2-methyl-1,3-oxazol-4-yl)oxane-4-carboxylic acid
PubChem CID96613959
Molecular FormulaC10H13NO4
Molecular Weight211.22 g/mol
Exact Mass211.08
IUPAC Name4-(2-methyl-1,3-oxazol-4-yl)oxane-4-carboxylic acid
SMILESCc1nc(C2(C(=O)O)CCOCC2)co1
InChIInChI=1S/C10H13NO4/c1-7-11-8(6-15-7)10(9(12)13)2-4-14-5-3-10/h6H,2-5H2,1H3,(H,12,13)
InChIKeyFKMZMQJBSAXXEA-UHFFFAOYSA-N
XLogP1.12
TPSA72.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.22
LogP ≤ 51.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-(2-methyl-1,3-oxazol-4-yl)oxane-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2-methyl-1,3-oxazol-4-yl)oxane-4-carboxylic acid?
The IUPAC name of 4-(2-methyl-1,3-oxazol-4-yl)oxane-4-carboxylic acid (CID 96613959) is 4-(2-methyl-1,3-oxazol-4-yl)oxane-4-carboxylic acid.
What is the SMILES notation for 4-(2-methyl-1,3-oxazol-4-yl)oxane-4-carboxylic acid?
The canonical SMILES for 4-(2-methyl-1,3-oxazol-4-yl)oxane-4-carboxylic acid is Cc1nc(C2(C(=O)O)CCOCC2)co1.
What is the InChIKey of 4-(2-methyl-1,3-oxazol-4-yl)oxane-4-carboxylic acid?
The InChIKey is FKMZMQJBSAXXEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO4/c1-7-11-8(6-15-7)10(9(12)13)2-4-14-5-3-10/h6H,2-5H2,1H3,(H,12,13).
What are the key properties of 4-(2-methyl-1,3-oxazol-4-yl)oxane-4-carboxylic acid?
4-(2-methyl-1,3-oxazol-4-yl)oxane-4-carboxylic acid has a molecular weight of 211.22 g/mol, XLogP of 1.12, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methyl-1,3-oxazol-4-yl)oxane-4-carboxylic acid is sourced from PubChem (CID 96613959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).