About 4-(2-methyl-1,3-oxazol-4-yl)oxane-4-carboxylic acid
4-(2-methyl-1,3-oxazol-4-yl)oxane-4-carboxylic acid (PubChem CID 96613959) has the molecular formula C10H13NO4
and a molecular weight of 211.22 g/mol. Its IUPAC name is 4-(2-methyl-1,3-oxazol-4-yl)oxane-4-carboxylic acid.
Molecular Properties
| Compound Name | 4-(2-methyl-1,3-oxazol-4-yl)oxane-4-carboxylic acid |
| PubChem CID | 96613959 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 4-(2-methyl-1,3-oxazol-4-yl)oxane-4-carboxylic acid |
| SMILES | Cc1nc(C2(C(=O)O)CCOCC2)co1 |
| InChI | InChI=1S/C10H13NO4/c1-7-11-8(6-15-7)10(9(12)13)2-4-14-5-3-10/h6H,2-5H2,1H3,(H,12,13) |
| InChIKey | FKMZMQJBSAXXEA-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-methyl-1,3-oxazol-4-yl)oxane-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methyl-1,3-oxazol-4-yl)oxane-4-carboxylic acid?
The IUPAC name of 4-(2-methyl-1,3-oxazol-4-yl)oxane-4-carboxylic acid (CID 96613959) is 4-(2-methyl-1,3-oxazol-4-yl)oxane-4-carboxylic acid.
What is the SMILES notation for 4-(2-methyl-1,3-oxazol-4-yl)oxane-4-carboxylic acid?
The canonical SMILES for 4-(2-methyl-1,3-oxazol-4-yl)oxane-4-carboxylic acid is Cc1nc(C2(C(=O)O)CCOCC2)co1.
What is the InChIKey of 4-(2-methyl-1,3-oxazol-4-yl)oxane-4-carboxylic acid?
The InChIKey is FKMZMQJBSAXXEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO4/c1-7-11-8(6-15-7)10(9(12)13)2-4-14-5-3-10/h6H,2-5H2,1H3,(H,12,13).
What are the key properties of 4-(2-methyl-1,3-oxazol-4-yl)oxane-4-carboxylic acid?
4-(2-methyl-1,3-oxazol-4-yl)oxane-4-carboxylic acid has a molecular weight of 211.22 g/mol, XLogP of 1.12, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methyl-1,3-oxazol-4-yl)oxane-4-carboxylic acid is sourced from PubChem (CID 96613959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).