About 6-methoxy-3,4-dihydro-2H-1-benzothiepin-5-one
6-methoxy-3,4-dihydro-2H-1-benzothiepin-5-one (PubChem CID 96615871) has the molecular formula C11H12O2S
and a molecular weight of 208.28 g/mol. Its IUPAC name is 6-methoxy-3,4-dihydro-2H-1-benzothiepin-5-one.
Molecular Properties
| Compound Name | 6-methoxy-3,4-dihydro-2H-1-benzothiepin-5-one |
| PubChem CID | 96615871 |
| Molecular Formula | C11H12O2S |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 6-methoxy-3,4-dihydro-2H-1-benzothiepin-5-one |
| SMILES | COc1cccc2c1C(=O)CCCS2 |
| InChI | InChI=1S/C11H12O2S/c1-13-9-5-2-6-10-11(9)8(12)4-3-7-14-10/h2,5-6H,3-4,7H2,1H3 |
| InChIKey | SORVMBJMZQWSFI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methoxy-3,4-dihydro-2H-1-benzothiepin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-3,4-dihydro-2H-1-benzothiepin-5-one?
The IUPAC name of 6-methoxy-3,4-dihydro-2H-1-benzothiepin-5-one (CID 96615871) is 6-methoxy-3,4-dihydro-2H-1-benzothiepin-5-one.
What is the SMILES notation for 6-methoxy-3,4-dihydro-2H-1-benzothiepin-5-one?
The canonical SMILES for 6-methoxy-3,4-dihydro-2H-1-benzothiepin-5-one is COc1cccc2c1C(=O)CCCS2.
What is the InChIKey of 6-methoxy-3,4-dihydro-2H-1-benzothiepin-5-one?
The InChIKey is SORVMBJMZQWSFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2S/c1-13-9-5-2-6-10-11(9)8(12)4-3-7-14-10/h2,5-6H,3-4,7H2,1H3.
What are the key properties of 6-methoxy-3,4-dihydro-2H-1-benzothiepin-5-one?
6-methoxy-3,4-dihydro-2H-1-benzothiepin-5-one has a molecular weight of 208.28 g/mol, XLogP of 2.76, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-3,4-dihydro-2H-1-benzothiepin-5-one is sourced from PubChem (CID 96615871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).