About 2-(methylamino)-1-(7-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl)ethanone
2-(methylamino)-1-(7-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl)ethanone (PubChem CID 96615896) has the molecular formula C10H16N4O
and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-(methylamino)-1-(7-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl)ethanone.
Molecular Properties
| Compound Name | 2-(methylamino)-1-(7-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl)ethanone |
| PubChem CID | 96615896 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 2-(methylamino)-1-(7-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl)ethanone |
| SMILES | CNCC(=O)c1cnc2n1CCN(C)C2 |
| InChI | InChI=1S/C10H16N4O/c1-11-6-9(15)8-5-12-10-7-13(2)3-4-14(8)10/h5,11H,3-4,6-7H2,1-2H3 |
| InChIKey | ZVCLETYQGJLFBT-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(methylamino)-1-(7-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methylamino)-1-(7-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl)ethanone?
The IUPAC name of 2-(methylamino)-1-(7-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl)ethanone (CID 96615896) is 2-(methylamino)-1-(7-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl)ethanone.
What is the SMILES notation for 2-(methylamino)-1-(7-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl)ethanone?
The canonical SMILES for 2-(methylamino)-1-(7-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl)ethanone is CNCC(=O)c1cnc2n1CCN(C)C2.
What is the InChIKey of 2-(methylamino)-1-(7-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl)ethanone?
The InChIKey is ZVCLETYQGJLFBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4O/c1-11-6-9(15)8-5-12-10-7-13(2)3-4-14(8)10/h5,11H,3-4,6-7H2,1-2H3.
What are the key properties of 2-(methylamino)-1-(7-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl)ethanone?
2-(methylamino)-1-(7-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl)ethanone has a molecular weight of 208.26 g/mol, XLogP of -0.27, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylamino)-1-(7-methyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-3-yl)ethanone is sourced from PubChem (CID 96615896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).