About 5-methyl-4-(5-methyl-1,2-oxazol-3-yl)thiophene-2-carbaldehyde
5-methyl-4-(5-methyl-1,2-oxazol-3-yl)thiophene-2-carbaldehyde (PubChem CID 96616781) has the molecular formula C10H9NO2S
and a molecular weight of 207.25 g/mol. Its IUPAC name is 5-methyl-4-(5-methyl-1,2-oxazol-3-yl)thiophene-2-carbaldehyde.
Molecular Properties
| Compound Name | 5-methyl-4-(5-methyl-1,2-oxazol-3-yl)thiophene-2-carbaldehyde |
| PubChem CID | 96616781 |
| Molecular Formula | C10H9NO2S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.04 |
| IUPAC Name | 5-methyl-4-(5-methyl-1,2-oxazol-3-yl)thiophene-2-carbaldehyde |
| SMILES | Cc1cc(-c2cc(C=O)sc2C)no1 |
| InChI | InChI=1S/C10H9NO2S/c1-6-3-10(11-13-6)9-4-8(5-12)14-7(9)2/h3-5H,1-2H3 |
| InChIKey | JVRCLFZHKWZZDU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-4-(5-methyl-1,2-oxazol-3-yl)thiophene-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4-(5-methyl-1,2-oxazol-3-yl)thiophene-2-carbaldehyde?
The IUPAC name of 5-methyl-4-(5-methyl-1,2-oxazol-3-yl)thiophene-2-carbaldehyde (CID 96616781) is 5-methyl-4-(5-methyl-1,2-oxazol-3-yl)thiophene-2-carbaldehyde.
What is the SMILES notation for 5-methyl-4-(5-methyl-1,2-oxazol-3-yl)thiophene-2-carbaldehyde?
The canonical SMILES for 5-methyl-4-(5-methyl-1,2-oxazol-3-yl)thiophene-2-carbaldehyde is Cc1cc(-c2cc(C=O)sc2C)no1.
What is the InChIKey of 5-methyl-4-(5-methyl-1,2-oxazol-3-yl)thiophene-2-carbaldehyde?
The InChIKey is JVRCLFZHKWZZDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2S/c1-6-3-10(11-13-6)9-4-8(5-12)14-7(9)2/h3-5H,1-2H3.
What are the key properties of 5-methyl-4-(5-methyl-1,2-oxazol-3-yl)thiophene-2-carbaldehyde?
5-methyl-4-(5-methyl-1,2-oxazol-3-yl)thiophene-2-carbaldehyde has a molecular weight of 207.25 g/mol, XLogP of 2.83, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4-(5-methyl-1,2-oxazol-3-yl)thiophene-2-carbaldehyde is sourced from PubChem (CID 96616781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).