About 2-[4-(1,2,4-triazin-6-ylmethyl)-1H-pyrazol-5-yl]ethanamine
2-[4-(1,2,4-triazin-6-ylmethyl)-1H-pyrazol-5-yl]ethanamine (PubChem CID 96618564) has the molecular formula C9H12N6
and a molecular weight of 204.24 g/mol. Its IUPAC name is 2-[4-(1,2,4-triazin-6-ylmethyl)-1H-pyrazol-5-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[4-(1,2,4-triazin-6-ylmethyl)-1H-pyrazol-5-yl]ethanamine |
| PubChem CID | 96618564 |
| Molecular Formula | C9H12N6 |
| Molecular Weight | 204.24 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 2-[4-(1,2,4-triazin-6-ylmethyl)-1H-pyrazol-5-yl]ethanamine |
| SMILES | NCCc1[nH]ncc1Cc1cncnn1 |
| InChI | InChI=1S/C9H12N6/c10-2-1-9-7(4-12-15-9)3-8-5-11-6-13-14-8/h4-6H,1-3,10H2,(H,12,15) |
| InChIKey | OJQHCZKUEAZDJJ-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.24 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(1,2,4-triazin-6-ylmethyl)-1H-pyrazol-5-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1,2,4-triazin-6-ylmethyl)-1H-pyrazol-5-yl]ethanamine?
The IUPAC name of 2-[4-(1,2,4-triazin-6-ylmethyl)-1H-pyrazol-5-yl]ethanamine (CID 96618564) is 2-[4-(1,2,4-triazin-6-ylmethyl)-1H-pyrazol-5-yl]ethanamine.
What is the SMILES notation for 2-[4-(1,2,4-triazin-6-ylmethyl)-1H-pyrazol-5-yl]ethanamine?
The canonical SMILES for 2-[4-(1,2,4-triazin-6-ylmethyl)-1H-pyrazol-5-yl]ethanamine is NCCc1[nH]ncc1Cc1cncnn1.
What is the InChIKey of 2-[4-(1,2,4-triazin-6-ylmethyl)-1H-pyrazol-5-yl]ethanamine?
The InChIKey is OJQHCZKUEAZDJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N6/c10-2-1-9-7(4-12-15-9)3-8-5-11-6-13-14-8/h4-6H,1-3,10H2,(H,12,15).
What are the key properties of 2-[4-(1,2,4-triazin-6-ylmethyl)-1H-pyrazol-5-yl]ethanamine?
2-[4-(1,2,4-triazin-6-ylmethyl)-1H-pyrazol-5-yl]ethanamine has a molecular weight of 204.24 g/mol, XLogP of -0.31, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1,2,4-triazin-6-ylmethyl)-1H-pyrazol-5-yl]ethanamine is sourced from PubChem (CID 96618564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).