About 1-furo[2,3-b]pyridin-2-ylcyclopentan-1-amine
1-furo[2,3-b]pyridin-2-ylcyclopentan-1-amine (PubChem CID 96619391) has the molecular formula C12H14N2O
and a molecular weight of 202.26 g/mol. Its IUPAC name is 1-furo[2,3-b]pyridin-2-ylcyclopentan-1-amine.
Molecular Properties
| Compound Name | 1-furo[2,3-b]pyridin-2-ylcyclopentan-1-amine |
| PubChem CID | 96619391 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 1-furo[2,3-b]pyridin-2-ylcyclopentan-1-amine |
| SMILES | NC1(c2cc3cccnc3o2)CCCC1 |
| InChI | InChI=1S/C12H14N2O/c13-12(5-1-2-6-12)10-8-9-4-3-7-14-11(9)15-10/h3-4,7-8H,1-2,5-6,13H2 |
| InChIKey | QONQQNVMCQIPSE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-furo[2,3-b]pyridin-2-ylcyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-furo[2,3-b]pyridin-2-ylcyclopentan-1-amine?
The IUPAC name of 1-furo[2,3-b]pyridin-2-ylcyclopentan-1-amine (CID 96619391) is 1-furo[2,3-b]pyridin-2-ylcyclopentan-1-amine.
What is the SMILES notation for 1-furo[2,3-b]pyridin-2-ylcyclopentan-1-amine?
The canonical SMILES for 1-furo[2,3-b]pyridin-2-ylcyclopentan-1-amine is NC1(c2cc3cccnc3o2)CCCC1.
What is the InChIKey of 1-furo[2,3-b]pyridin-2-ylcyclopentan-1-amine?
The InChIKey is QONQQNVMCQIPSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O/c13-12(5-1-2-6-12)10-8-9-4-3-7-14-11(9)15-10/h3-4,7-8H,1-2,5-6,13H2.
What are the key properties of 1-furo[2,3-b]pyridin-2-ylcyclopentan-1-amine?
1-furo[2,3-b]pyridin-2-ylcyclopentan-1-amine has a molecular weight of 202.26 g/mol, XLogP of 2.56, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-furo[2,3-b]pyridin-2-ylcyclopentan-1-amine is sourced from PubChem (CID 96619391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).