C11H11N3O — CID 96619751
8-methoxy-4,5-dihydroimidazo[1,5-a]quinoxaline (PubChem CID 96619751) has the molecular formula C11H11N3O and a molecular weight of 201.23 g/mol. Its IUPAC name is 8-methoxy-4,5-dihydroimidazo[1,5-a]quinoxaline.
| Compound Name | 8-methoxy-4,5-dihydroimidazo[1,5-a]quinoxaline |
|---|---|
| PubChem CID | 96619751 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 8-methoxy-4,5-dihydroimidazo[1,5-a]quinoxaline |
| SMILES | COc1ccc2c(c1)-n1cncc1CN2 |
| InChI | InChI=1S/C11H11N3O/c1-15-9-2-3-10-11(4-9)14-7-12-5-8(14)6-13-10/h2-5,7,13H,6H2,1H3 |
| InChIKey | YQXCPXBKYWWVFH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|