About 7-(1,2-oxazol-4-yl)furo[3,2-c]pyridin-6-amine
7-(1,2-oxazol-4-yl)furo[3,2-c]pyridin-6-amine (PubChem CID 96619815) has the molecular formula C10H7N3O2
and a molecular weight of 201.19 g/mol. Its IUPAC name is 7-(1,2-oxazol-4-yl)furo[3,2-c]pyridin-6-amine.
Molecular Properties
| Compound Name | 7-(1,2-oxazol-4-yl)furo[3,2-c]pyridin-6-amine |
| PubChem CID | 96619815 |
| Molecular Formula | C10H7N3O2 |
| Molecular Weight | 201.19 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | 7-(1,2-oxazol-4-yl)furo[3,2-c]pyridin-6-amine |
| SMILES | Nc1ncc2ccoc2c1-c1cnoc1 |
| InChI | InChI=1S/C10H7N3O2/c11-10-8(7-4-13-15-5-7)9-6(3-12-10)1-2-14-9/h1-5H,(H2,11,12) |
| InChIKey | WZAPQZADRQQENM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 78.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.19 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-(1,2-oxazol-4-yl)furo[3,2-c]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(1,2-oxazol-4-yl)furo[3,2-c]pyridin-6-amine?
The IUPAC name of 7-(1,2-oxazol-4-yl)furo[3,2-c]pyridin-6-amine (CID 96619815) is 7-(1,2-oxazol-4-yl)furo[3,2-c]pyridin-6-amine.
What is the SMILES notation for 7-(1,2-oxazol-4-yl)furo[3,2-c]pyridin-6-amine?
The canonical SMILES for 7-(1,2-oxazol-4-yl)furo[3,2-c]pyridin-6-amine is Nc1ncc2ccoc2c1-c1cnoc1.
What is the InChIKey of 7-(1,2-oxazol-4-yl)furo[3,2-c]pyridin-6-amine?
The InChIKey is WZAPQZADRQQENM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3O2/c11-10-8(7-4-13-15-5-7)9-6(3-12-10)1-2-14-9/h1-5H,(H2,11,12).
What are the key properties of 7-(1,2-oxazol-4-yl)furo[3,2-c]pyridin-6-amine?
7-(1,2-oxazol-4-yl)furo[3,2-c]pyridin-6-amine has a molecular weight of 201.19 g/mol, XLogP of 2.07, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(1,2-oxazol-4-yl)furo[3,2-c]pyridin-6-amine is sourced from PubChem (CID 96619815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).