About 5-phenylfuro[2,3-d][1,2]oxazol-3-amine
5-phenylfuro[2,3-d][1,2]oxazol-3-amine (PubChem CID 96620339) has the molecular formula C11H8N2O2
and a molecular weight of 200.20 g/mol. Its IUPAC name is 5-phenylfuro[2,3-d][1,2]oxazol-3-amine.
Molecular Properties
| Compound Name | 5-phenylfuro[2,3-d][1,2]oxazol-3-amine |
| PubChem CID | 96620339 |
| Molecular Formula | C11H8N2O2 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 5-phenylfuro[2,3-d][1,2]oxazol-3-amine |
| SMILES | Nc1noc2cc(-c3ccccc3)oc12 |
| InChI | InChI=1S/C11H8N2O2/c12-11-10-9(15-13-11)6-8(14-10)7-4-2-1-3-5-7/h1-6H,(H2,12,13) |
| InChIKey | HPRXUURAWKEGGE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-phenylfuro[2,3-d][1,2]oxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenylfuro[2,3-d][1,2]oxazol-3-amine?
The IUPAC name of 5-phenylfuro[2,3-d][1,2]oxazol-3-amine (CID 96620339) is 5-phenylfuro[2,3-d][1,2]oxazol-3-amine.
What is the SMILES notation for 5-phenylfuro[2,3-d][1,2]oxazol-3-amine?
The canonical SMILES for 5-phenylfuro[2,3-d][1,2]oxazol-3-amine is Nc1noc2cc(-c3ccccc3)oc12.
What is the InChIKey of 5-phenylfuro[2,3-d][1,2]oxazol-3-amine?
The InChIKey is HPRXUURAWKEGGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O2/c12-11-10-9(15-13-11)6-8(14-10)7-4-2-1-3-5-7/h1-6H,(H2,12,13).
What are the key properties of 5-phenylfuro[2,3-d][1,2]oxazol-3-amine?
5-phenylfuro[2,3-d][1,2]oxazol-3-amine has a molecular weight of 200.20 g/mol, XLogP of 2.67, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenylfuro[2,3-d][1,2]oxazol-3-amine is sourced from PubChem (CID 96620339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).