C10H19N3O — CID 96621391
(3aS,7aR)-5-(2-aminoethyl)-1-methyl-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-4-one (PubChem CID 96621391) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is (3aS,7aR)-5-(2-aminoethyl)-1-methyl-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-4-one.
| Compound Name | (3aS,7aR)-5-(2-aminoethyl)-1-methyl-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 96621391 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | (3aS,7aR)-5-(2-aminoethyl)-1-methyl-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-4-one |
| SMILES | CN1CC[C@@H]2C(=O)N(CCN)CC[C@H]21 |
| InChI | InChI=1S/C10H19N3O/c1-12-5-2-8-9(12)3-6-13(7-4-11)10(8)14/h8-9H,2-7,11H2,1H3/t8-,9+/m0/s1 |
| InChIKey | IGFFNDNSCQKBTH-DTWKUNHWSA-N |
| XLogP | -0.50 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |