C10H13NOS — CID 96622382
spiro[5,6-dihydrothieno[2,3-b]pyrrole-4,4'-oxane] (PubChem CID 96622382) has the molecular formula C10H13NOS and a molecular weight of 195.29 g/mol. Its IUPAC name is spiro[5,6-dihydrothieno[2,3-b]pyrrole-4,4'-oxane].
| Compound Name | spiro[5,6-dihydrothieno[2,3-b]pyrrole-4,4'-oxane] |
|---|---|
| PubChem CID | 96622382 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | spiro[5,6-dihydrothieno[2,3-b]pyrrole-4,4'-oxane] |
| SMILES | c1cc2c(s1)NCC21CCOCC1 |
| InChI | InChI=1S/C10H13NOS/c1-6-13-9-8(1)10(7-11-9)2-4-12-5-3-10/h1,6,11H,2-5,7H2 |
| InChIKey | ULDMFIATUYPHCO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |