2-(1,5-dimethylfuro[3,2-c]pyrazol-3-yl)acetic acid

C9H10N2O3 — CID 96623386

IUPAC2-(1,5-dimethylfuro[3,2-c]pyrazol-3-yl)acetic acid
SMILESCc1cc2c(o1)c(CC(=O)O)nn2C
InChIInChI=1S/C9H10N2O3/c1-5-3-7-9(14-5)6(4-8(12)13)10-11(7)2/h3H,4H2,1-2H3,(H,12,13)
InChIKeyXAMAQDWPLODXPA-UHFFFAOYSA-N
MW194.19 g/mol
LogP1.10
Rot. Bonds2

About 2-(1,5-dimethylfuro[3,2-c]pyrazol-3-yl)acetic acid

2-(1,5-dimethylfuro[3,2-c]pyrazol-3-yl)acetic acid (PubChem CID 96623386) has the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. Its IUPAC name is 2-(1,5-dimethylfuro[3,2-c]pyrazol-3-yl)acetic acid.

Molecular Properties

Compound Name2-(1,5-dimethylfuro[3,2-c]pyrazol-3-yl)acetic acid
PubChem CID96623386
Molecular FormulaC9H10N2O3
Molecular Weight194.19 g/mol
Exact Mass194.07
IUPAC Name2-(1,5-dimethylfuro[3,2-c]pyrazol-3-yl)acetic acid
SMILESCc1cc2c(o1)c(CC(=O)O)nn2C
InChIInChI=1S/C9H10N2O3/c1-5-3-7-9(14-5)6(4-8(12)13)10-11(7)2/h3H,4H2,1-2H3,(H,12,13)
InChIKeyXAMAQDWPLODXPA-UHFFFAOYSA-N
XLogP1.10
TPSA68.26 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.19
LogP ≤ 51.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(1,5-dimethylfuro[3,2-c]pyrazol-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,5-dimethylfuro[3,2-c]pyrazol-3-yl)acetic acid?
The IUPAC name of 2-(1,5-dimethylfuro[3,2-c]pyrazol-3-yl)acetic acid (CID 96623386) is 2-(1,5-dimethylfuro[3,2-c]pyrazol-3-yl)acetic acid.
What is the SMILES notation for 2-(1,5-dimethylfuro[3,2-c]pyrazol-3-yl)acetic acid?
The canonical SMILES for 2-(1,5-dimethylfuro[3,2-c]pyrazol-3-yl)acetic acid is Cc1cc2c(o1)c(CC(=O)O)nn2C.
What is the InChIKey of 2-(1,5-dimethylfuro[3,2-c]pyrazol-3-yl)acetic acid?
The InChIKey is XAMAQDWPLODXPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O3/c1-5-3-7-9(14-5)6(4-8(12)13)10-11(7)2/h3H,4H2,1-2H3,(H,12,13).
What are the key properties of 2-(1,5-dimethylfuro[3,2-c]pyrazol-3-yl)acetic acid?
2-(1,5-dimethylfuro[3,2-c]pyrazol-3-yl)acetic acid has a molecular weight of 194.19 g/mol, XLogP of 1.10, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,5-dimethylfuro[3,2-c]pyrazol-3-yl)acetic acid is sourced from PubChem (CID 96623386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).