About 2-piperazin-1-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole
2-piperazin-1-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole (PubChem CID 96624056) has the molecular formula C10H16N4
and a molecular weight of 192.27 g/mol. Its IUPAC name is 2-piperazin-1-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole.
Molecular Properties
| Compound Name | 2-piperazin-1-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole |
| PubChem CID | 96624056 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 2-piperazin-1-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole |
| SMILES | c1c(N2CCNCC2)nc2n1CCC2 |
| InChI | InChI=1S/C10H16N4/c1-2-9-12-10(8-14(9)5-1)13-6-3-11-4-7-13/h8,11H,1-7H2 |
| InChIKey | NTVAACYVSWPVHX-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-piperazin-1-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperazin-1-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The IUPAC name of 2-piperazin-1-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole (CID 96624056) is 2-piperazin-1-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole.
What is the SMILES notation for 2-piperazin-1-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The canonical SMILES for 2-piperazin-1-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole is c1c(N2CCNCC2)nc2n1CCC2.
What is the InChIKey of 2-piperazin-1-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The InChIKey is NTVAACYVSWPVHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4/c1-2-9-12-10(8-14(9)5-1)13-6-3-11-4-7-13/h8,11H,1-7H2.
What are the key properties of 2-piperazin-1-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
2-piperazin-1-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole has a molecular weight of 192.27 g/mol, XLogP of 0.24, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperazin-1-yl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole is sourced from PubChem (CID 96624056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).