C8H8N4S — CID 96624150
6,7,8,9-tetrahydro-[1,2,5]thiadiazolo[3,4-c][2,7]naphthyridine (PubChem CID 96624150) has the molecular formula C8H8N4S and a molecular weight of 192.25 g/mol. Its IUPAC name is 6,7,8,9-tetrahydro-[1,2,5]thiadiazolo[3,4-c][2,7]naphthyridine.
| Compound Name | 6,7,8,9-tetrahydro-[1,2,5]thiadiazolo[3,4-c][2,7]naphthyridine |
|---|---|
| PubChem CID | 96624150 |
| Molecular Formula | C8H8N4S |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 6,7,8,9-tetrahydro-[1,2,5]thiadiazolo[3,4-c][2,7]naphthyridine |
| SMILES | c1nc2nsnc2c2c1CNCC2 |
| InChI | InChI=1S/C8H8N4S/c1-2-9-3-5-4-10-8-7(6(1)5)11-13-12-8/h4,9H,1-3H2 |
| InChIKey | KFZZMDQRWXRWQQ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |